About lithium 2-octylphenolate
lithium 2-octylphenolate (PubChem CID 23700762) has the molecular formula C14H21LiO
and a molecular weight of 212.26 g/mol. Its IUPAC name is lithium 2-octylphenolate.
Molecular Properties
| Compound Name | lithium 2-octylphenolate |
| PubChem CID | 23700762 |
| Molecular Formula | C14H21LiO |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | lithium 2-octylphenolate |
| SMILES | CCCCCCCCc1ccccc1[O-].[Li+] |
| InChI | InChI=1S/C14H22O.Li/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15;/h8-9,11-12,15H,2-7,10H2,1H3;/q;+1/p-1 |
| InChIKey | AJOYJIHFMMTCEX-UHFFFAOYSA-M |
| XLogP | 0.67 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze lithium 2-octylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-octylphenolate?
The IUPAC name of lithium 2-octylphenolate (CID 23700762) is lithium 2-octylphenolate.
What is the SMILES notation for lithium 2-octylphenolate?
The canonical SMILES for lithium 2-octylphenolate is CCCCCCCCc1ccccc1[O-].[Li+].
What is the InChIKey of lithium 2-octylphenolate?
The InChIKey is AJOYJIHFMMTCEX-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H22O.Li/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15;/h8-9,11-12,15H,2-7,10H2,1H3;/q;+1/p-1.
What are the key properties of lithium 2-octylphenolate?
lithium 2-octylphenolate has a molecular weight of 212.26 g/mol, XLogP of 0.67, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-octylphenolate is sourced from PubChem (CID 23700762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).