About cadmium(2+);bis(2-heptylphenolate)
cadmium(2+);bis(2-heptylphenolate) (PubChem CID 101292517) has the molecular formula C26H38CdO2
and a molecular weight of 495.00 g/mol. Its IUPAC name is cadmium(2+);bis(2-heptylphenolate).
Molecular Properties
| Compound Name | cadmium(2+);bis(2-heptylphenolate) |
| PubChem CID | 101292517 |
| Molecular Formula | C26H38CdO2 |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | cadmium(2+);bis(2-heptylphenolate) |
| SMILES | CCCCCCCc1ccccc1[O-].CCCCCCCc1ccccc1[O-].[Cd+2] |
| InChI | InChI=1S/2C13H20O.Cd/c2*1-2-3-4-5-6-9-12-10-7-8-11-13(12)14;/h2*7-8,10-11,14H,2-6,9H2,1H3;/q;;+2/p-2 |
| InChIKey | GZILLJHDFSTVSO-UHFFFAOYSA-L |
| XLogP | 6.54 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cadmium(2+);bis(2-heptylphenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);bis(2-heptylphenolate)?
The IUPAC name of cadmium(2+);bis(2-heptylphenolate) (CID 101292517) is cadmium(2+);bis(2-heptylphenolate).
What is the SMILES notation for cadmium(2+);bis(2-heptylphenolate)?
The canonical SMILES for cadmium(2+);bis(2-heptylphenolate) is CCCCCCCc1ccccc1[O-].CCCCCCCc1ccccc1[O-].[Cd+2].
What is the InChIKey of cadmium(2+);bis(2-heptylphenolate)?
The InChIKey is GZILLJHDFSTVSO-UHFFFAOYSA-L. The full InChI is InChI=1S/2C13H20O.Cd/c2*1-2-3-4-5-6-9-12-10-7-8-11-13(12)14;/h2*7-8,10-11,14H,2-6,9H2,1H3;/q;;+2/p-2.
What are the key properties of cadmium(2+);bis(2-heptylphenolate)?
cadmium(2+);bis(2-heptylphenolate) has a molecular weight of 495.00 g/mol, XLogP of 6.54, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);bis(2-heptylphenolate) is sourced from PubChem (CID 101292517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).