C16H24F2O2 — CID 154435751
3-(10,10-difluorodecyl)benzene-1,2-diol (PubChem CID 154435751) has the molecular formula C16H24F2O2 and a molecular weight of 286.36 g/mol. Its IUPAC name is 3-(10,10-difluorodecyl)benzene-1,2-diol.
| Compound Name | 3-(10,10-difluorodecyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 154435751 |
| Molecular Formula | C16H24F2O2 |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 3-(10,10-difluorodecyl)benzene-1,2-diol |
| SMILES | Oc1cccc(CCCCCCCCCC(F)F)c1O |
| InChI | InChI=1S/C16H24F2O2/c17-15(18)12-7-5-3-1-2-4-6-9-13-10-8-11-14(19)16(13)20/h8,10-11,15,19-20H,1-7,9,12H2 |
| InChIKey | WGEBDSBRKXBGHE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|