C10H13FO2 — CID 68899588
3-(4-fluorobutyl)benzene-1,2-diol (PubChem CID 68899588) has the molecular formula C10H13FO2 and a molecular weight of 184.21 g/mol. Its IUPAC name is 3-(4-fluorobutyl)benzene-1,2-diol.
| Compound Name | 3-(4-fluorobutyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 68899588 |
| Molecular Formula | C10H13FO2 |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 3-(4-fluorobutyl)benzene-1,2-diol |
| SMILES | Oc1cccc(CCCCF)c1O |
| InChI | InChI=1S/C10H13FO2/c11-7-2-1-4-8-5-3-6-9(12)10(8)13/h3,5-6,12-13H,1-2,4,7H2 |
| InChIKey | MYRXCQICTYZOMO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|