C14H20I2O2 — CID 154435592
3-(8,8-diiodooctyl)benzene-1,2-diol (PubChem CID 154435592) has the molecular formula C14H20I2O2 and a molecular weight of 474.12 g/mol. Its IUPAC name is 3-(8,8-diiodooctyl)benzene-1,2-diol.
| Compound Name | 3-(8,8-diiodooctyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 154435592 |
| Molecular Formula | C14H20I2O2 |
| Molecular Weight | 474.12 g/mol |
| Exact Mass | 473.96 |
| IUPAC Name | 3-(8,8-diiodooctyl)benzene-1,2-diol |
| SMILES | Oc1cccc(CCCCCCCC(I)I)c1O |
| InChI | InChI=1S/C14H20I2O2/c15-13(16)10-5-3-1-2-4-7-11-8-6-9-12(17)14(11)18/h6,8-9,13,17-18H,1-5,7,10H2 |
| InChIKey | HUIVVMDTNCYUHN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.12 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|