C20H34O4 — CID 154435636
3-(8,8-dipropoxyoctyl)benzene-1,2-diol (PubChem CID 154435636) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 3-(8,8-dipropoxyoctyl)benzene-1,2-diol.
| Compound Name | 3-(8,8-dipropoxyoctyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 154435636 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 3-(8,8-dipropoxyoctyl)benzene-1,2-diol |
| SMILES | CCCOC(CCCCCCCc1cccc(O)c1O)OCCC |
| InChI | InChI=1S/C20H34O4/c1-3-15-23-19(24-16-4-2)14-9-7-5-6-8-11-17-12-10-13-18(21)20(17)22/h10,12-13,19,21-22H,3-9,11,14-16H2,1-2H3 |
| InChIKey | HUHJBNQZTPDEHN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|