[3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate

C37H66O6 — CID 69498528

IUPAC[3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate
SMILESCCCCCCCCCCOC(CCCCCCCCCc1cccc(OC(=O)O)c1O)OCCCCCCCCCC
InChIInChI=1S/C37H66O6/c1-3-5-7-9-11-16-20-24-31-41-35(42-32-25-21-17-12-10-8-6-4-2)30-23-19-15-13-14-18-22-27-33-28-26-29-34(36(33)38)43-37(39)40/h26,28-29,35,38H,3-25,27,30-32H2,1-2H3,(H,39,40)
InChIKeyMFGICZYNPURLBR-UHFFFAOYSA-N
MW606.93 g/mol
LogP11.75
Rot. Bonds31

About [3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate

[3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate (PubChem CID 69498528) has the molecular formula C37H66O6 and a molecular weight of 606.93 g/mol. Its IUPAC name is [3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate.

Molecular Properties

Compound Name[3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate
PubChem CID69498528
Molecular FormulaC37H66O6
Molecular Weight606.93 g/mol
Exact Mass606.49
IUPAC Name[3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate
SMILESCCCCCCCCCCOC(CCCCCCCCCc1cccc(OC(=O)O)c1O)OCCCCCCCCCC
InChIInChI=1S/C37H66O6/c1-3-5-7-9-11-16-20-24-31-41-35(42-32-25-21-17-12-10-8-6-4-2)30-23-19-15-13-14-18-22-27-33-28-26-29-34(36(33)38)43-37(39)40/h26,28-29,35,38H,3-25,27,30-32H2,1-2H3,(H,39,40)
InChIKeyMFGICZYNPURLBR-UHFFFAOYSA-N
XLogP11.75
TPSA85.22 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds31
Heavy Atoms43
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500606.93
LogP ≤ 511.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}

Analyze [3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate?
The IUPAC name of [3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate (CID 69498528) is [3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate.
What is the SMILES notation for [3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate?
The canonical SMILES for [3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate is CCCCCCCCCCOC(CCCCCCCCCc1cccc(OC(=O)O)c1O)OCCCCCCCCCC.
What is the InChIKey of [3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate?
The InChIKey is MFGICZYNPURLBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H66O6/c1-3-5-7-9-11-16-20-24-31-41-35(42-32-25-21-17-12-10-8-6-4-2)30-23-19-15-13-14-18-22-27-33-28-26-29-34(36(33)38)43-37(39)40/h26,28-29,35,38H,3-25,27,30-32H2,1-2H3,(H,39,40).
What are the key properties of [3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate?
[3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate has a molecular weight of 606.93 g/mol, XLogP of 11.75, 31 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(10,10-didecoxydecyl)-2-hydroxyphenyl] hydrogen carbonate is sourced from PubChem (CID 69498528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).