C9H10Cl2O2 — CID 154435171
3-(3,3-dichloropropyl)benzene-1,2-diol (PubChem CID 154435171) has the molecular formula C9H10Cl2O2 and a molecular weight of 221.08 g/mol. Its IUPAC name is 3-(3,3-dichloropropyl)benzene-1,2-diol.
| Compound Name | 3-(3,3-dichloropropyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 154435171 |
| Molecular Formula | C9H10Cl2O2 |
| Molecular Weight | 221.08 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 3-(3,3-dichloropropyl)benzene-1,2-diol |
| SMILES | Oc1cccc(CCC(Cl)Cl)c1O |
| InChI | InChI=1S/C9H10Cl2O2/c10-8(11)5-4-6-2-1-3-7(12)9(6)13/h1-3,8,12-13H,4-5H2 |
| InChIKey | CMLWDPBJHWRRGZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.08 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|