C14H15NO3 — CID 129382233
3-[(3R)-3-hydroxy-3-pyridin-2-ylpropyl]benzene-1,2-diol (PubChem CID 129382233) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-[(3R)-3-hydroxy-3-pyridin-2-ylpropyl]benzene-1,2-diol.
| Compound Name | 3-[(3R)-3-hydroxy-3-pyridin-2-ylpropyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 129382233 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 3-[(3R)-3-hydroxy-3-pyridin-2-ylpropyl]benzene-1,2-diol |
| SMILES | Oc1cccc(CC[C@@H](O)c2ccccn2)c1O |
| InChI | InChI=1S/C14H15NO3/c16-12(11-5-1-2-9-15-11)8-7-10-4-3-6-13(17)14(10)18/h1-6,9,12,16-18H,7-8H2/t12-/m1/s1 |
| InChIKey | ICYYBBDIKVGQTR-GFCCVEGCSA-N |
| XLogP | 2.16 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|