C8H10O4 — CID 70364634
3-(2,2-dihydroxyethyl)benzene-1,2-diol (PubChem CID 70364634) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is 3-(2,2-dihydroxyethyl)benzene-1,2-diol.
| Compound Name | 3-(2,2-dihydroxyethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 70364634 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 3-(2,2-dihydroxyethyl)benzene-1,2-diol |
| SMILES | Oc1cccc(CC(O)O)c1O |
| InChI | InChI=1S/C8H10O4/c9-6-3-1-2-5(8(6)12)4-7(10)11/h1-3,7,9-12H,4H2 |
| InChIKey | OMSWFXVQPZAXDT-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|