C9H14NO8P — CID 174776848
2-amino-3-(2,3-dihydroxyphenyl)propanoic acid;phosphoric acid (PubChem CID 174776848) has the molecular formula C9H14NO8P and a molecular weight of 295.18 g/mol. Its IUPAC name is 2-amino-3-(2,3-dihydroxyphenyl)propanoic acid;phosphoric acid.
| Compound Name | 2-amino-3-(2,3-dihydroxyphenyl)propanoic acid;phosphoric acid |
|---|---|
| PubChem CID | 174776848 |
| Molecular Formula | C9H14NO8P |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-amino-3-(2,3-dihydroxyphenyl)propanoic acid;phosphoric acid |
| SMILES | NC(Cc1cccc(O)c1O)C(=O)O.O=P(O)(O)O |
| InChI | InChI=1S/C9H11NO4.H3O4P/c10-6(9(13)14)4-5-2-1-3-7(11)8(5)12;1-5(2,3)4/h1-3,6,11-12H,4,10H2,(H,13,14);(H3,1,2,3,4) |
| InChIKey | MVGXOGHKHKVQSF-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 181.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|