C13H10Br2O4 — CID 151978519
3,4-dibromo-5-[(2,3-dihydroxyphenyl)methyl]benzene-1,2-diol (PubChem CID 151978519) has the molecular formula C13H10Br2O4 and a molecular weight of 390.03 g/mol. Its IUPAC name is 3,4-dibromo-5-[(2,3-dihydroxyphenyl)methyl]benzene-1,2-diol.
| Compound Name | 3,4-dibromo-5-[(2,3-dihydroxyphenyl)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 151978519 |
| Molecular Formula | C13H10Br2O4 |
| Molecular Weight | 390.03 g/mol |
| Exact Mass | 387.89 |
| IUPAC Name | 3,4-dibromo-5-[(2,3-dihydroxyphenyl)methyl]benzene-1,2-diol |
| SMILES | Oc1cccc(Cc2cc(O)c(O)c(Br)c2Br)c1O |
| InChI | InChI=1S/C13H10Br2O4/c14-10-7(5-9(17)13(19)11(10)15)4-6-2-1-3-8(16)12(6)18/h1-3,5,16-19H,4H2 |
| InChIKey | UCEDRADAMRPROE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.03 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|