C15H14Br2O6 — CID 11293865
3,4-dibromo-5-[[2,4-dihydroxy-6-(hydroxymethyl)-3-methoxyphenyl]methyl]benzene-1,2-diol (PubChem CID 11293865) has the molecular formula C15H14Br2O6 and a molecular weight of 450.08 g/mol. Its IUPAC name is 3,4-dibromo-5-[[2,4-dihydroxy-6-(hydroxymethyl)-3-methoxyphenyl]methyl]benzene-1,2-diol.
| Compound Name | 3,4-dibromo-5-[[2,4-dihydroxy-6-(hydroxymethyl)-3-methoxyphenyl]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 11293865 |
| Molecular Formula | C15H14Br2O6 |
| Molecular Weight | 450.08 g/mol |
| Exact Mass | 447.92 |
| IUPAC Name | 3,4-dibromo-5-[[2,4-dihydroxy-6-(hydroxymethyl)-3-methoxyphenyl]methyl]benzene-1,2-diol |
| SMILES | COc1c(O)cc(CO)c(Cc2cc(O)c(O)c(Br)c2Br)c1O |
| InChI | InChI=1S/C15H14Br2O6/c1-23-15-10(20)4-7(5-18)8(13(15)21)2-6-3-9(19)14(22)12(17)11(6)16/h3-4,18-22H,2,5H2,1H3 |
| InChIKey | LORWRPGVVXJIGB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.08 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|