C14H12Br2O5 — CID 3081007
3-bromo-4-[(3-bromo-4,5-dihydroxyphenyl)methyl]-5-(hydroxymethyl)benzene-1,2-diol (PubChem CID 3081007) has the molecular formula C14H12Br2O5 and a molecular weight of 420.05 g/mol. Its IUPAC name is 3-bromo-4-[(3-bromo-4,5-dihydroxyphenyl)methyl]-5-(hydroxymethyl)benzene-1,2-diol.
| Compound Name | 3-bromo-4-[(3-bromo-4,5-dihydroxyphenyl)methyl]-5-(hydroxymethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 3081007 |
| Molecular Formula | C14H12Br2O5 |
| Molecular Weight | 420.05 g/mol |
| Exact Mass | 417.91 |
| IUPAC Name | 3-bromo-4-[(3-bromo-4,5-dihydroxyphenyl)methyl]-5-(hydroxymethyl)benzene-1,2-diol |
| SMILES | OCc1cc(O)c(O)c(Br)c1Cc1cc(O)c(O)c(Br)c1 |
| InChI | InChI=1S/C14H12Br2O5/c15-9-2-6(3-10(18)13(9)20)1-8-7(5-17)4-11(19)14(21)12(8)16/h2-4,17-21H,1,5H2 |
| InChIKey | SEXYDDXUERLOFL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.05 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|