C19H17Br3O7 — CID 162854649
[2-acetyloxy-4-bromo-3-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]-5-(methoxymethyl)phenyl] acetate (PubChem CID 162854649) has the molecular formula C19H17Br3O7 and a molecular weight of 597.05 g/mol. Its IUPAC name is [2-acetyloxy-4-bromo-3-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]-5-(methoxymethyl)phenyl] acetate.
| Compound Name | [2-acetyloxy-4-bromo-3-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]-5-(methoxymethyl)phenyl] acetate |
|---|---|
| PubChem CID | 162854649 |
| Molecular Formula | C19H17Br3O7 |
| Molecular Weight | 597.05 g/mol |
| Exact Mass | 593.85 |
| IUPAC Name | [2-acetyloxy-4-bromo-3-[(2,3-dibromo-4,5-dihydroxyphenyl)methyl]-5-(methoxymethyl)phenyl] acetate |
| SMILES | COCc1cc(OC(C)=O)c(OC(C)=O)c(Cc2cc(O)c(O)c(Br)c2Br)c1Br |
| InChI | InChI=1S/C19H17Br3O7/c1-8(23)28-14-6-11(7-27-3)15(20)12(19(14)29-9(2)24)4-10-5-13(25)18(26)17(22)16(10)21/h5-6,25-26H,4,7H2,1-3H3 |
| InChIKey | ZLLVZZUXYHJBLA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.05 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|