C14H16O7 — CID 14261267
[2,3-diacetyloxy-5-(methoxymethyl)phenyl] acetate (PubChem CID 14261267) has the molecular formula C14H16O7 and a molecular weight of 296.28 g/mol. Its IUPAC name is [2,3-diacetyloxy-5-(methoxymethyl)phenyl] acetate.
| Compound Name | [2,3-diacetyloxy-5-(methoxymethyl)phenyl] acetate |
|---|---|
| PubChem CID | 14261267 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | [2,3-diacetyloxy-5-(methoxymethyl)phenyl] acetate |
| SMILES | COCc1cc(OC(C)=O)c(OC(C)=O)c(OC(C)=O)c1 |
| InChI | InChI=1S/C14H16O7/c1-8(15)19-12-5-11(7-18-4)6-13(20-9(2)16)14(12)21-10(3)17/h5-6H,7H2,1-4H3 |
| InChIKey | CAHWHTZJKRNHIT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|