C13H17NO6 — CID 170879558
3-(4-acetyloxy-3,5-dimethoxyphenyl)-2-aminopropanoic acid (PubChem CID 170879558) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is 3-(4-acetyloxy-3,5-dimethoxyphenyl)-2-aminopropanoic acid.
| Compound Name | 3-(4-acetyloxy-3,5-dimethoxyphenyl)-2-aminopropanoic acid |
|---|---|
| PubChem CID | 170879558 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 3-(4-acetyloxy-3,5-dimethoxyphenyl)-2-aminopropanoic acid |
| SMILES | COc1cc(CC(N)C(=O)O)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C13H17NO6/c1-7(15)20-12-10(18-2)5-8(6-11(12)19-3)4-9(14)13(16)17/h5-6,9H,4,14H2,1-3H3,(H,16,17) |
| InChIKey | QJFMMMVXUXKMFC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|