C13H19NO4 — CID 117385929
2-amino-3-(4,5-dimethoxy-2,3-dimethylphenyl)propanoic acid (PubChem CID 117385929) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-amino-3-(4,5-dimethoxy-2,3-dimethylphenyl)propanoic acid.
| Compound Name | 2-amino-3-(4,5-dimethoxy-2,3-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117385929 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-amino-3-(4,5-dimethoxy-2,3-dimethylphenyl)propanoic acid |
| SMILES | COc1cc(CC(N)C(=O)O)c(C)c(C)c1OC |
| InChI | InChI=1S/C13H19NO4/c1-7-8(2)12(18-4)11(17-3)6-9(7)5-10(14)13(15)16/h6,10H,5,14H2,1-4H3,(H,15,16) |
| InChIKey | FKIBBLQCZWRNPR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |