2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid

C14H21NO4 — CID 117421669

IUPAC2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid
SMILESCOc1cc(CC(N)C(=O)O)c(C(C)C)cc1OC
InChIInChI=1S/C14H21NO4/c1-8(2)10-7-13(19-4)12(18-3)6-9(10)5-11(15)14(16)17/h6-8,11H,5,15H2,1-4H3,(H,16,17)
InChIKeyCAMOJHIKDMPYHY-UHFFFAOYSA-N
MW267.32 g/mol
LogP1.78
Rot. Bonds6

About 2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid

2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid (PubChem CID 117421669) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid.

Molecular Properties

Compound Name2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid
PubChem CID117421669
Molecular FormulaC14H21NO4
Molecular Weight267.32 g/mol
Exact Mass267.15
IUPAC Name2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid
SMILESCOc1cc(CC(N)C(=O)O)c(C(C)C)cc1OC
InChIInChI=1S/C14H21NO4/c1-8(2)10-7-13(19-4)12(18-3)6-9(10)5-11(15)14(16)17/h6-8,11H,5,15H2,1-4H3,(H,16,17)
InChIKeyCAMOJHIKDMPYHY-UHFFFAOYSA-N
XLogP1.78
TPSA81.78 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.32
LogP ≤ 51.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid?
The IUPAC name of 2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid (CID 117421669) is 2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid.
What is the SMILES notation for 2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid?
The canonical SMILES for 2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid is COc1cc(CC(N)C(=O)O)c(C(C)C)cc1OC.
What is the InChIKey of 2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid?
The InChIKey is CAMOJHIKDMPYHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4/c1-8(2)10-7-13(19-4)12(18-3)6-9(10)5-11(15)14(16)17/h6-8,11H,5,15H2,1-4H3,(H,16,17).
What are the key properties of 2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid?
2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid has a molecular weight of 267.32 g/mol, XLogP of 1.78, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(4,5-dimethoxy-2-propan-2-ylphenyl)propanoic acid is sourced from PubChem (CID 117421669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).