C14H15NO6 — CID 15337094
(2R)-2-amino-3-(6,7-dimethoxy-2-oxochromen-4-yl)propanoic acid (PubChem CID 15337094) has the molecular formula C14H15NO6 and a molecular weight of 293.28 g/mol. Its IUPAC name is (2R)-2-amino-3-(6,7-dimethoxy-2-oxochromen-4-yl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(6,7-dimethoxy-2-oxochromen-4-yl)propanoic acid |
|---|---|
| PubChem CID | 15337094 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (2R)-2-amino-3-(6,7-dimethoxy-2-oxochromen-4-yl)propanoic acid |
| SMILES | COc1cc2oc(=O)cc(C[C@@H](N)C(=O)O)c2cc1OC |
| InChI | InChI=1S/C14H15NO6/c1-19-11-5-8-7(3-9(15)14(17)18)4-13(16)21-10(8)6-12(11)20-2/h4-6,9H,3,15H2,1-2H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | GKVCKTGEIBUCEK-SECBINFHSA-N |
| XLogP | 0.76 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|