C12H11ClO4 — CID 12070149
4-(chloromethyl)-6,7-dimethoxychromen-2-one (PubChem CID 12070149) has the molecular formula C12H11ClO4 and a molecular weight of 254.67 g/mol. Its IUPAC name is 4-(chloromethyl)-6,7-dimethoxychromen-2-one.
| Compound Name | 4-(chloromethyl)-6,7-dimethoxychromen-2-one |
|---|---|
| PubChem CID | 12070149 |
| Molecular Formula | C12H11ClO4 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 4-(chloromethyl)-6,7-dimethoxychromen-2-one |
| SMILES | COc1cc2oc(=O)cc(CCl)c2cc1OC |
| InChI | InChI=1S/C12H11ClO4/c1-15-10-4-8-7(6-13)3-12(14)17-9(8)5-11(10)16-2/h3-5H,6H2,1-2H3 |
| InChIKey | JUINCLWPPKPHNW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|