C19H18O7 — CID 45276755
4-(4-hydroxy-3,5-dimethoxyphenyl)-6,7-dimethoxychromen-2-one (PubChem CID 45276755) has the molecular formula C19H18O7 and a molecular weight of 358.35 g/mol. Its IUPAC name is 4-(4-hydroxy-3,5-dimethoxyphenyl)-6,7-dimethoxychromen-2-one.
| Compound Name | 4-(4-hydroxy-3,5-dimethoxyphenyl)-6,7-dimethoxychromen-2-one |
|---|---|
| PubChem CID | 45276755 |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 4-(4-hydroxy-3,5-dimethoxyphenyl)-6,7-dimethoxychromen-2-one |
| SMILES | COc1cc2oc(=O)cc(-c3cc(OC)c(O)c(OC)c3)c2cc1OC |
| InChI | InChI=1S/C19H18O7/c1-22-14-7-12-11(8-18(20)26-13(12)9-15(14)23-2)10-5-16(24-3)19(21)17(6-10)25-4/h5-9,21H,1-4H3 |
| InChIKey | GKUCKXFRGHSENJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|