C15H16O6 — CID 11358293
ethyl 2-(6,7-dimethoxy-2-oxochromen-4-yl)acetate (PubChem CID 11358293) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is ethyl 2-(6,7-dimethoxy-2-oxochromen-4-yl)acetate.
| Compound Name | ethyl 2-(6,7-dimethoxy-2-oxochromen-4-yl)acetate |
|---|---|
| PubChem CID | 11358293 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | ethyl 2-(6,7-dimethoxy-2-oxochromen-4-yl)acetate |
| SMILES | CCOC(=O)Cc1cc(=O)oc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C15H16O6/c1-4-20-14(16)5-9-6-15(17)21-11-8-13(19-3)12(18-2)7-10(9)11/h6-8H,4-5H2,1-3H3 |
| InChIKey | CBUOPNXYLXAZQD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|