C14H17BF4O4S — CID 139891508
(6,7-dimethoxy-2-oxochromen-4-yl)methyl-dimethylsulfanium tetrafluoroborate (PubChem CID 139891508) has the molecular formula C14H17BF4O4S and a molecular weight of 368.16 g/mol. Its IUPAC name is (6,7-dimethoxy-2-oxochromen-4-yl)methyl-dimethylsulfanium tetrafluoroborate.
| Compound Name | (6,7-dimethoxy-2-oxochromen-4-yl)methyl-dimethylsulfanium tetrafluoroborate |
|---|---|
| PubChem CID | 139891508 |
| Molecular Formula | C14H17BF4O4S |
| Molecular Weight | 368.16 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (6,7-dimethoxy-2-oxochromen-4-yl)methyl-dimethylsulfanium tetrafluoroborate |
| SMILES | COc1cc2oc(=O)cc(C[S+](C)C)c2cc1OC.F[B-](F)(F)F |
| InChI | InChI=1S/C14H17O4S.BF4/c1-16-12-6-10-9(8-19(3)4)5-14(15)18-11(10)7-13(12)17-2;2-1(3,4)5/h5-7H,8H2,1-4H3;/q+1;-1 |
| InChIKey | OTSDYOMVBBIURL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.16 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|