C23H28NO5+ — CID 8551911
(4,5-dimethoxy-2-methylphenyl)methyl-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl]-methylazanium (PubChem CID 8551911) has the molecular formula C23H28NO5+ and a molecular weight of 398.48 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)methyl-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl]-methylazanium.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)methyl-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8551911 |
| Molecular Formula | C23H28NO5+ |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)methyl-[(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl]-methylazanium |
| SMILES | CCc1cc2c(C[NH+](C)Cc3cc(OC)c(OC)cc3C)cc(=O)oc2cc1O |
| InChI | InChI=1S/C23H27NO5/c1-6-15-8-18-17(10-23(26)29-20(18)11-19(15)25)13-24(3)12-16-9-22(28-5)21(27-4)7-14(16)2/h7-11,25H,6,12-13H2,1-5H3/p+1 |
| InChIKey | NWSKLUIWXPHTEB-UHFFFAOYSA-O |
| XLogP | 2.60 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|