C24H30NO5+ — CID 9234514
(4,5-dimethoxy-2-methylphenyl)methyl-[(6-ethyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methyl]-methylazanium (PubChem CID 9234514) has the molecular formula C24H30NO5+ and a molecular weight of 412.51 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)methyl-[(6-ethyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methyl]-methylazanium.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)methyl-[(6-ethyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9234514 |
| Molecular Formula | C24H30NO5+ |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)methyl-[(6-ethyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methyl]-methylazanium |
| SMILES | CCc1cc2c(C)cc(=O)oc2c(C[NH+](C)Cc2cc(OC)c(OC)cc2C)c1O |
| InChI | InChI=1S/C24H29NO5/c1-7-16-10-18-15(3)9-22(26)30-24(18)19(23(16)27)13-25(4)12-17-11-21(29-6)20(28-5)8-14(17)2/h8-11,27H,7,12-13H2,1-6H3/p+1 |
| InChIKey | RXCXAMRZGVFVRU-UHFFFAOYSA-O |
| XLogP | 2.91 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|