C22H27N3O3+2 — CID 9280566
6-ethyl-7-hydroxy-4-methyl-8-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]chromen-2-one (PubChem CID 9280566) has the molecular formula C22H27N3O3+2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 6-ethyl-7-hydroxy-4-methyl-8-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]chromen-2-one.
| Compound Name | 6-ethyl-7-hydroxy-4-methyl-8-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 9280566 |
| Molecular Formula | C22H27N3O3+2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 6-ethyl-7-hydroxy-4-methyl-8-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]chromen-2-one |
| SMILES | CCc1cc2c(C)cc(=O)oc2c(C[NH+]2CCN(c3cc[nH+]cc3)CC2)c1O |
| InChI | InChI=1S/C22H25N3O3/c1-3-16-13-18-15(2)12-20(26)28-22(18)19(21(16)27)14-24-8-10-25(11-9-24)17-4-6-23-7-5-17/h4-7,12-13,27H,3,8-11,14H2,1-2H3/p+2 |
| InChIKey | XEBCUDQSEWHPRY-UHFFFAOYSA-P |
| XLogP | 1.09 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|