C19H24NO6+ — CID 11938202
methyl (2S,4S)-1-[(6-ethyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methyl]-4-hydroxypyrrolidin-1-ium-2-carboxylate (PubChem CID 11938202) has the molecular formula C19H24NO6+ and a molecular weight of 362.40 g/mol. Its IUPAC name is methyl (2S,4S)-1-[(6-ethyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methyl]-4-hydroxypyrrolidin-1-ium-2-carboxylate.
| Compound Name | methyl (2S,4S)-1-[(6-ethyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methyl]-4-hydroxypyrrolidin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 11938202 |
| Molecular Formula | C19H24NO6+ |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | methyl (2S,4S)-1-[(6-ethyl-7-hydroxy-4-methyl-2-oxochromen-8-yl)methyl]-4-hydroxypyrrolidin-1-ium-2-carboxylate |
| SMILES | CCc1cc2c(C)cc(=O)oc2c(C[NH+]2C[C@@H](O)C[C@H]2C(=O)OC)c1O |
| InChI | InChI=1S/C19H23NO6/c1-4-11-6-13-10(2)5-16(22)26-18(13)14(17(11)23)9-20-8-12(21)7-15(20)19(24)25-3/h5-6,12,15,21,23H,4,7-9H2,1-3H3/p+1/t12-,15-/m0/s1 |
| InChIKey | ZGMQMKKKTBPRIJ-WFASDCNBSA-O |
| XLogP | 0.06 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|