C17H21ClNO3+ — CID 6929361
6-chloro-7-hydroxy-4-methyl-8-[[(2S)-2-methylpiperidin-1-ium-1-yl]methyl]chromen-2-one (PubChem CID 6929361) has the molecular formula C17H21ClNO3+ and a molecular weight of 322.81 g/mol. Its IUPAC name is 6-chloro-7-hydroxy-4-methyl-8-[[(2S)-2-methylpiperidin-1-ium-1-yl]methyl]chromen-2-one.
| Compound Name | 6-chloro-7-hydroxy-4-methyl-8-[[(2S)-2-methylpiperidin-1-ium-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 6929361 |
| Molecular Formula | C17H21ClNO3+ |
| Molecular Weight | 322.81 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 6-chloro-7-hydroxy-4-methyl-8-[[(2S)-2-methylpiperidin-1-ium-1-yl]methyl]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c(C[NH+]3CCCC[C@@H]3C)c(O)c(Cl)cc12 |
| InChI | InChI=1S/C17H20ClNO3/c1-10-7-15(20)22-17-12(10)8-14(18)16(21)13(17)9-19-6-4-3-5-11(19)2/h7-8,11,21H,3-6,9H2,1-2H3/p+1/t11-/m0/s1 |
| InChIKey | AQLWHGSBHINSIW-NSHDSACASA-O |
| XLogP | 2.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.81 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|