C17H23ClN2O+2 — CID 4096946
8-chloro-2-methyl-3-[(2-methylpiperidin-1-ium-1-yl)methyl]quinolin-1-ium-4-ol (PubChem CID 4096946) has the molecular formula C17H23ClN2O+2 and a molecular weight of 306.84 g/mol. Its IUPAC name is 8-chloro-2-methyl-3-[(2-methylpiperidin-1-ium-1-yl)methyl]quinolin-1-ium-4-ol.
| Compound Name | 8-chloro-2-methyl-3-[(2-methylpiperidin-1-ium-1-yl)methyl]quinolin-1-ium-4-ol |
|---|---|
| PubChem CID | 4096946 |
| Molecular Formula | C17H23ClN2O+2 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 8-chloro-2-methyl-3-[(2-methylpiperidin-1-ium-1-yl)methyl]quinolin-1-ium-4-ol |
| SMILES | Cc1[nH+]c2c(Cl)cccc2c(O)c1C[NH+]1CCCCC1C |
| InChI | InChI=1S/C17H21ClN2O/c1-11-6-3-4-9-20(11)10-14-12(2)19-16-13(17(14)21)7-5-8-15(16)18/h5,7-8,11H,3-4,6,9-10H2,1-2H3,(H,19,21)/p+2 |
| InChIKey | HHZMRPYWQIYNQQ-UHFFFAOYSA-P |
| XLogP | 2.28 |
| TPSA | 38.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |