C16H20ClN2O2+ — CID 6957537
5-chloro-7-[[(2R)-2-(hydroxymethyl)piperidin-1-ium-1-yl]methyl]quinolin-8-ol (PubChem CID 6957537) has the molecular formula C16H20ClN2O2+ and a molecular weight of 307.80 g/mol. Its IUPAC name is 5-chloro-7-[[(2R)-2-(hydroxymethyl)piperidin-1-ium-1-yl]methyl]quinolin-8-ol.
| Compound Name | 5-chloro-7-[[(2R)-2-(hydroxymethyl)piperidin-1-ium-1-yl]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 6957537 |
| Molecular Formula | C16H20ClN2O2+ |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 5-chloro-7-[[(2R)-2-(hydroxymethyl)piperidin-1-ium-1-yl]methyl]quinolin-8-ol |
| SMILES | OC[C@H]1CCCC[NH+]1Cc1cc(Cl)c2cccnc2c1O |
| InChI | InChI=1S/C16H19ClN2O2/c17-14-8-11(9-19-7-2-1-4-12(19)10-20)16(21)15-13(14)5-3-6-18-15/h3,5-6,8,12,20-21H,1-2,4,7,9-10H2/p+1/t12-/m1/s1 |
| InChIKey | IHWVLTMHSJFRLI-GFCCVEGCSA-O |
| XLogP | 1.52 |
| TPSA | 57.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|