C15H20Cl3N3O — CID 131888000
5-chloro-7-[(4-methylpiperazin-1-yl)methyl]quinolin-8-ol;dihydrochloride (PubChem CID 131888000) has the molecular formula C15H20Cl3N3O and a molecular weight of 364.70 g/mol. Its IUPAC name is 5-chloro-7-[(4-methylpiperazin-1-yl)methyl]quinolin-8-ol;dihydrochloride.
| Compound Name | 5-chloro-7-[(4-methylpiperazin-1-yl)methyl]quinolin-8-ol;dihydrochloride |
|---|---|
| PubChem CID | 131888000 |
| Molecular Formula | C15H20Cl3N3O |
| Molecular Weight | 364.70 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 5-chloro-7-[(4-methylpiperazin-1-yl)methyl]quinolin-8-ol;dihydrochloride |
| SMILES | CN1CCN(Cc2cc(Cl)c3cccnc3c2O)CC1.Cl.Cl |
| InChI | InChI=1S/C15H18ClN3O.2ClH/c1-18-5-7-19(8-6-18)10-11-9-13(16)12-3-2-4-17-14(12)15(11)20;;/h2-4,9,20H,5-8,10H2,1H3;2*1H |
| InChIKey | XGLJSZDSZKWTIP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.70 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|