C21H21ClN4O2 — CID 3464185
[5-chloro-7-[(4-methylpiperazin-1-yl)methyl]quinolin-8-yl] pyridine-4-carboxylate (PubChem CID 3464185) has the molecular formula C21H21ClN4O2 and a molecular weight of 396.88 g/mol. Its IUPAC name is [5-chloro-7-[(4-methylpiperazin-1-yl)methyl]quinolin-8-yl] pyridine-4-carboxylate.
| Compound Name | [5-chloro-7-[(4-methylpiperazin-1-yl)methyl]quinolin-8-yl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 3464185 |
| Molecular Formula | C21H21ClN4O2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [5-chloro-7-[(4-methylpiperazin-1-yl)methyl]quinolin-8-yl] pyridine-4-carboxylate |
| SMILES | CN1CCN(Cc2cc(Cl)c3cccnc3c2OC(=O)c2ccncc2)CC1 |
| InChI | InChI=1S/C21H21ClN4O2/c1-25-9-11-26(12-10-25)14-16-13-18(22)17-3-2-6-24-19(17)20(16)28-21(27)15-4-7-23-8-5-15/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | DPXYQYWDPLJBKE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|