C25H35N5O5 — CID 3471245
ethyl 4-[[7-[(4-ethoxycarbonylpiperazin-1-yl)methyl]-8-hydroxyquinolin-5-yl]methyl]piperazine-1-carboxylate (PubChem CID 3471245) has the molecular formula C25H35N5O5 and a molecular weight of 485.59 g/mol. Its IUPAC name is ethyl 4-[[7-[(4-ethoxycarbonylpiperazin-1-yl)methyl]-8-hydroxyquinolin-5-yl]methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[7-[(4-ethoxycarbonylpiperazin-1-yl)methyl]-8-hydroxyquinolin-5-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 3471245 |
| Molecular Formula | C25H35N5O5 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | ethyl 4-[[7-[(4-ethoxycarbonylpiperazin-1-yl)methyl]-8-hydroxyquinolin-5-yl]methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(Cc2cc(CN3CCN(C(=O)OCC)CC3)c3cccnc3c2O)CC1 |
| InChI | InChI=1S/C25H35N5O5/c1-3-34-24(32)29-12-8-27(9-13-29)17-19-16-20(23(31)22-21(19)6-5-7-26-22)18-28-10-14-30(15-11-28)25(33)35-4-2/h5-7,16,31H,3-4,8-15,17-18H2,1-2H3 |
| InChIKey | RALOKAOJUPBBFD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 98.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|