C22H20Cl3N3O2 — CID 4514076
[5-chloro-7-[(4-methylpiperazin-1-yl)methyl]quinolin-8-yl] 2,4-dichlorobenzoate (PubChem CID 4514076) has the molecular formula C22H20Cl3N3O2 and a molecular weight of 464.78 g/mol. Its IUPAC name is [5-chloro-7-[(4-methylpiperazin-1-yl)methyl]quinolin-8-yl] 2,4-dichlorobenzoate.
| Compound Name | [5-chloro-7-[(4-methylpiperazin-1-yl)methyl]quinolin-8-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4514076 |
| Molecular Formula | C22H20Cl3N3O2 |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | [5-chloro-7-[(4-methylpiperazin-1-yl)methyl]quinolin-8-yl] 2,4-dichlorobenzoate |
| SMILES | CN1CCN(Cc2cc(Cl)c3cccnc3c2OC(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C22H20Cl3N3O2/c1-27-7-9-28(10-8-27)13-14-11-18(24)16-3-2-6-26-20(16)21(14)30-22(29)17-5-4-15(23)12-19(17)25/h2-6,11-12H,7-10,13H2,1H3 |
| InChIKey | ZVSJUJGCHKKLDU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|