C16H19ClN4O2 — CID 58368629
5-chloro-8-[4-(2-hydroxyethyl)piperazin-1-yl]quinoline-7-carboxamide (PubChem CID 58368629) has the molecular formula C16H19ClN4O2 and a molecular weight of 334.81 g/mol. Its IUPAC name is 5-chloro-8-[4-(2-hydroxyethyl)piperazin-1-yl]quinoline-7-carboxamide.
| Compound Name | 5-chloro-8-[4-(2-hydroxyethyl)piperazin-1-yl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 58368629 |
| Molecular Formula | C16H19ClN4O2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 5-chloro-8-[4-(2-hydroxyethyl)piperazin-1-yl]quinoline-7-carboxamide |
| SMILES | NC(=O)c1cc(Cl)c2cccnc2c1N1CCN(CCO)CC1 |
| InChI | InChI=1S/C16H19ClN4O2/c17-13-10-12(16(18)23)15(14-11(13)2-1-3-19-14)21-6-4-20(5-7-21)8-9-22/h1-3,10,22H,4-9H2,(H2,18,23) |
| InChIKey | RVRRSEGCJBBTJA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |