C21H19ClN4O2 — CID 87323983
2-[5-chloro-8-[4-(pyridine-3-carbonyl)piperazin-1-yl]quinolin-7-yl]acetaldehyde (PubChem CID 87323983) has the molecular formula C21H19ClN4O2 and a molecular weight of 394.86 g/mol. Its IUPAC name is 2-[5-chloro-8-[4-(pyridine-3-carbonyl)piperazin-1-yl]quinolin-7-yl]acetaldehyde.
| Compound Name | 2-[5-chloro-8-[4-(pyridine-3-carbonyl)piperazin-1-yl]quinolin-7-yl]acetaldehyde |
|---|---|
| PubChem CID | 87323983 |
| Molecular Formula | C21H19ClN4O2 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-[5-chloro-8-[4-(pyridine-3-carbonyl)piperazin-1-yl]quinolin-7-yl]acetaldehyde |
| SMILES | O=CCc1cc(Cl)c2cccnc2c1N1CCN(C(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C21H19ClN4O2/c22-18-13-15(5-12-27)20(19-17(18)4-2-7-24-19)25-8-10-26(11-9-25)21(28)16-3-1-6-23-14-16/h1-4,6-7,12-14H,5,8-11H2 |
| InChIKey | GLXWKCFDZQLUOW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|