C22H22ClFN4O — CID 67247043
[4-[7-(2-aminoethyl)-5-chloroquinolin-8-yl]piperazin-1-yl]-(4-fluorophenyl)methanone (PubChem CID 67247043) has the molecular formula C22H22ClFN4O and a molecular weight of 412.90 g/mol. Its IUPAC name is [4-[7-(2-aminoethyl)-5-chloroquinolin-8-yl]piperazin-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [4-[7-(2-aminoethyl)-5-chloroquinolin-8-yl]piperazin-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 67247043 |
| Molecular Formula | C22H22ClFN4O |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [4-[7-(2-aminoethyl)-5-chloroquinolin-8-yl]piperazin-1-yl]-(4-fluorophenyl)methanone |
| SMILES | NCCc1cc(Cl)c2cccnc2c1N1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H22ClFN4O/c23-19-14-16(7-8-25)21(20-18(19)2-1-9-26-20)27-10-12-28(13-11-27)22(29)15-3-5-17(24)6-4-15/h1-6,9,14H,7-8,10-13,25H2 |
| InChIKey | ZAJGIYDSYVHLLJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |