C17H15Cl2FN2O — CID 17217210
[4-(3,4-dichlorophenyl)piperazin-1-yl]-(4-fluorophenyl)methanone (PubChem CID 17217210) has the molecular formula C17H15Cl2FN2O and a molecular weight of 353.22 g/mol. Its IUPAC name is [4-(3,4-dichlorophenyl)piperazin-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [4-(3,4-dichlorophenyl)piperazin-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 17217210 |
| Molecular Formula | C17H15Cl2FN2O |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | [4-(3,4-dichlorophenyl)piperazin-1-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H15Cl2FN2O/c18-15-6-5-14(11-16(15)19)21-7-9-22(10-8-21)17(23)12-1-3-13(20)4-2-12/h1-6,11H,7-10H2 |
| InChIKey | SGNRDPMKECLLQE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |