C16H14Cl2FN3O — CID 46798589
(5,6-dichloro-3-pyridinyl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 46798589) has the molecular formula C16H14Cl2FN3O and a molecular weight of 354.21 g/mol. Its IUPAC name is (5,6-dichloro-3-pyridinyl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | (5,6-dichloro-3-pyridinyl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46798589 |
| Molecular Formula | C16H14Cl2FN3O |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | (5,6-dichloro-3-pyridinyl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cnc(Cl)c(Cl)c1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H14Cl2FN3O/c17-14-9-11(10-20-15(14)18)16(23)22-7-5-21(6-8-22)13-3-1-12(19)2-4-13/h1-4,9-10H,5-8H2 |
| InChIKey | NSCPRJIKWMVSAR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|