C15H14Cl2FN3O2S — CID 110295034
1-[(5,6-dichloro-3-pyridinyl)sulfonyl]-4-(4-fluorophenyl)piperazine (PubChem CID 110295034) has the molecular formula C15H14Cl2FN3O2S and a molecular weight of 390.27 g/mol. Its IUPAC name is 1-[(5,6-dichloro-3-pyridinyl)sulfonyl]-4-(4-fluorophenyl)piperazine.
| Compound Name | 1-[(5,6-dichloro-3-pyridinyl)sulfonyl]-4-(4-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 110295034 |
| Molecular Formula | C15H14Cl2FN3O2S |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 1-[(5,6-dichloro-3-pyridinyl)sulfonyl]-4-(4-fluorophenyl)piperazine |
| SMILES | O=S(=O)(c1cnc(Cl)c(Cl)c1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C15H14Cl2FN3O2S/c16-14-9-13(10-19-15(14)17)24(22,23)21-7-5-20(6-8-21)12-3-1-11(18)2-4-12/h1-4,9-10H,5-8H2 |
| InChIKey | NJHHSJWOITVQAH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|