C13H15ClN4O2S — CID 60915587
1-(4-chlorophenyl)-4-(1H-pyrazol-4-ylsulfonyl)piperazine (PubChem CID 60915587) has the molecular formula C13H15ClN4O2S and a molecular weight of 326.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-(1H-pyrazol-4-ylsulfonyl)piperazine.
| Compound Name | 1-(4-chlorophenyl)-4-(1H-pyrazol-4-ylsulfonyl)piperazine |
|---|---|
| PubChem CID | 60915587 |
| Molecular Formula | C13H15ClN4O2S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 1-(4-chlorophenyl)-4-(1H-pyrazol-4-ylsulfonyl)piperazine |
| SMILES | O=S(=O)(c1cn[nH]c1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C13H15ClN4O2S/c14-11-1-3-12(4-2-11)17-5-7-18(8-6-17)21(19,20)13-9-15-16-10-13/h1-4,9-10H,5-8H2,(H,15,16) |
| InChIKey | XZMNYZGGAGMPKA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |