C14H14Cl2N4O3S — CID 26436355
5-chloro-4-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-1H-pyridazin-6-one (PubChem CID 26436355) has the molecular formula C14H14Cl2N4O3S and a molecular weight of 389.26 g/mol. Its IUPAC name is 5-chloro-4-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 26436355 |
| Molecular Formula | C14H14Cl2N4O3S |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 5-chloro-4-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(N2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)c1Cl |
| InChI | InChI=1S/C14H14Cl2N4O3S/c15-10-1-3-11(4-2-10)24(22,23)20-7-5-19(6-8-20)12-9-17-18-14(21)13(12)16/h1-4,9H,5-8H2,(H,18,21) |
| InChIKey | FQHYWYPGCICGAB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |