C15H17BClN3O4S — CID 71463927
[6-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]boronic acid (PubChem CID 71463927) has the molecular formula C15H17BClN3O4S and a molecular weight of 381.65 g/mol. Its IUPAC name is [6-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]boronic acid.
| Compound Name | [6-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 71463927 |
| Molecular Formula | C15H17BClN3O4S |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | [6-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]boronic acid |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCN(c2ccc(B(O)O)cn2)CC1 |
| InChI | InChI=1S/C15H17BClN3O4S/c17-13-2-4-14(5-3-13)25(23,24)20-9-7-19(8-10-20)15-6-1-12(11-18-15)16(21)22/h1-6,11,21-22H,7-10H2 |
| InChIKey | JDAUUSKHFBENJG-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|