C17H23ClN4O — CID 67301551
2-[4-[7-(1-aminoethyl)-5-chloroquinolin-8-yl]piperazin-1-yl]ethanol (PubChem CID 67301551) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is 2-[4-[7-(1-aminoethyl)-5-chloroquinolin-8-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[7-(1-aminoethyl)-5-chloroquinolin-8-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 67301551 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-[4-[7-(1-aminoethyl)-5-chloroquinolin-8-yl]piperazin-1-yl]ethanol |
| SMILES | CC(N)c1cc(Cl)c2cccnc2c1N1CCN(CCO)CC1 |
| InChI | InChI=1S/C17H23ClN4O/c1-12(19)14-11-15(18)13-3-2-4-20-16(13)17(14)22-7-5-21(6-8-22)9-10-23/h2-4,11-12,23H,5-10,19H2,1H3 |
| InChIKey | MSLYHUZAFPXBSB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |