C14H22FN3O — CID 43592142
2-[4-[2-(1-aminoethyl)-4-fluorophenyl]piperazin-1-yl]ethanol (PubChem CID 43592142) has the molecular formula C14H22FN3O and a molecular weight of 267.35 g/mol. Its IUPAC name is 2-[4-[2-(1-aminoethyl)-4-fluorophenyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[2-(1-aminoethyl)-4-fluorophenyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 43592142 |
| Molecular Formula | C14H22FN3O |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-[4-[2-(1-aminoethyl)-4-fluorophenyl]piperazin-1-yl]ethanol |
| SMILES | CC(N)c1cc(F)ccc1N1CCN(CCO)CC1 |
| InChI | InChI=1S/C14H22FN3O/c1-11(16)13-10-12(15)2-3-14(13)18-6-4-17(5-7-18)8-9-19/h2-3,10-11,19H,4-9,16H2,1H3 |
| InChIKey | SGSMDPGZCDQAAK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |