C12H17FN2OS — CID 63368739
(1R)-1-[5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanamine (PubChem CID 63368739) has the molecular formula C12H17FN2OS and a molecular weight of 256.35 g/mol. Its IUPAC name is (1R)-1-[5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanamine.
| Compound Name | (1R)-1-[5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 63368739 |
| Molecular Formula | C12H17FN2OS |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | (1R)-1-[5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanamine |
| SMILES | C[C@@H](N)c1cc(F)ccc1N1CCS(=O)CC1 |
| InChI | InChI=1S/C12H17FN2OS/c1-9(14)11-8-10(13)2-3-12(11)15-4-6-17(16)7-5-15/h2-3,8-9H,4-7,14H2,1H3/t9-/m1/s1 |
| InChIKey | OHBWRBTXDHQLDI-SECBINFHSA-N |
| XLogP | 1.41 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |