C11H11FN2OS — CID 63667343
5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzonitrile (PubChem CID 63667343) has the molecular formula C11H11FN2OS and a molecular weight of 238.29 g/mol. Its IUPAC name is 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzonitrile.
| Compound Name | 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzonitrile |
|---|---|
| PubChem CID | 63667343 |
| Molecular Formula | C11H11FN2OS |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzonitrile |
| SMILES | N#Cc1cc(F)ccc1N1CCS(=O)CC1 |
| InChI | InChI=1S/C11H11FN2OS/c12-10-1-2-11(9(7-10)8-13)14-3-5-16(15)6-4-14/h1-2,7H,3-6H2 |
| InChIKey | PYQJVIYSNIQHKC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |