C12H14FNO2S — CID 54976767
1-[5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanone (PubChem CID 54976767) has the molecular formula C12H14FNO2S and a molecular weight of 255.31 g/mol. Its IUPAC name is 1-[5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanone.
| Compound Name | 1-[5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 54976767 |
| Molecular Formula | C12H14FNO2S |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 1-[5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanone |
| SMILES | CC(=O)c1cc(F)ccc1N1CCS(=O)CC1 |
| InChI | InChI=1S/C12H14FNO2S/c1-9(15)11-8-10(13)2-3-12(11)14-4-6-17(16)7-5-14/h2-3,8H,4-7H2,1H3 |
| InChIKey | ZJMOKKORDUKFJF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |