C11H14FN3OS — CID 63667633
5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzenecarboximidamide (PubChem CID 63667633) has the molecular formula C11H14FN3OS and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzenecarboximidamide.
| Compound Name | 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 63667633 |
| Molecular Formula | C11H14FN3OS |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)ccc1N1CCS(=O)CC1 |
| InChI | InChI=1S/C11H14FN3OS/c12-8-1-2-10(9(7-8)11(13)14)15-3-5-17(16)6-4-15/h1-2,7H,3-6H2,(H3,13,14) |
| InChIKey | OVYLTJSYAPNIPN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|